C29H40ClN5O6 — CID 157324829
(2R,5S)-2-[3-(carbamoylamino)propyl]-N-[4-(chloromethyl)phenyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide (PubChem CID 157324829) has the molecular formula C29H40ClN5O6 and a molecular weight of 590.12 g/mol. Its IUPAC name is (2R,5S)-2-[3-(carbamoylamino)propyl]-N-[4-(chloromethyl)phenyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-N-[4-(chloromethyl)phenyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 157324829 |
| Molecular Formula | C29H40ClN5O6 |
| Molecular Weight | 590.12 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-N-[4-(chloromethyl)phenyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)C[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CCl)cc1 |
| InChI | InChI=1S/C29H40ClN5O6/c1-19(2)27(34-24(37)8-4-3-5-16-35-25(38)13-14-26(35)39)23(36)17-21(7-6-15-32-29(31)41)28(40)33-22-11-9-20(18-30)10-12-22/h9-14,19,21,27H,3-8,15-18H2,1-2H3,(H,33,40)(H,34,37)(H3,31,32,41)/t21-,27+/m1/s1 |
| InChIKey | ZLTVNIHUEAGXPJ-ZBLYBZFDSA-N |
| XLogP | 3.01 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|