C25H41N5O6 — CID 161197714
(5S)-2-[3-(carbamoylamino)propyl]-N-[(2R)-1-deuteriopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide (PubChem CID 161197714) has the molecular formula C25H41N5O6 and a molecular weight of 508.64 g/mol. Its IUPAC name is (5S)-2-[3-(carbamoylamino)propyl]-N-[(2R)-1-deuteriopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide.
| Compound Name | (5S)-2-[3-(carbamoylamino)propyl]-N-[(2R)-1-deuteriopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 161197714 |
| Molecular Formula | C25H41N5O6 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | (5S)-2-[3-(carbamoylamino)propyl]-N-[(2R)-1-deuteriopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
| SMILES | [2H]C[C@@H](C)NC(=O)C(CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C25H41N5O6/c1-16(2)23(29-20(32)10-6-5-7-14-30-21(33)11-12-22(30)34)19(31)15-18(24(35)28-17(3)4)9-8-13-27-25(26)36/h11-12,16-18,23H,5-10,13-15H2,1-4H3,(H,28,35)(H,29,32)(H3,26,27,36)/t18?,23-/m0/s1/i3D/t17-,18?,23- |
| InChIKey | UUOJKIOGDVKPOI-VYMMLFOJSA-N |
| XLogP | 1.16 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|