C28H45N5O7 — CID 162152382
(2R,5S)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-deuterio-4-methyl-1-oxopentan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide (PubChem CID 162152382) has the molecular formula C28H45N5O7 and a molecular weight of 564.70 g/mol. Its IUPAC name is (2R,5S)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-deuterio-4-methyl-1-oxopentan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-deuterio-4-methyl-1-oxopentan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 162152382 |
| Molecular Formula | C28H45N5O7 |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-deuterio-4-methyl-1-oxopentan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
| SMILES | [2H]C(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C28H45N5O7/c1-18(2)15-21(17-34)31-27(39)20(9-8-13-30-28(29)40)16-22(35)26(19(3)4)32-23(36)10-6-5-7-14-33-24(37)11-12-25(33)38/h11-12,17-21,26H,5-10,13-16H2,1-4H3,(H,31,39)(H,32,36)(H3,29,30,40)/t20-,21+,26+/m1/s1/i17D |
| InChIKey | ZLJPXOVOKGDNLU-ARCHPKPUSA-N |
| XLogP | 1.37 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|