C24H38N4O7 — CID 158270971
(2R,5S,6R)-2-(4-aminobutyl)-N-[(2S)-1-deuterio-1-oxopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-hydroxy-4-oxoheptanamide (PubChem CID 158270971) has the molecular formula C24H38N4O7 and a molecular weight of 495.60 g/mol. Its IUPAC name is (2R,5S,6R)-2-(4-aminobutyl)-N-[(2S)-1-deuterio-1-oxopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-hydroxy-4-oxoheptanamide.
| Compound Name | (2R,5S,6R)-2-(4-aminobutyl)-N-[(2S)-1-deuterio-1-oxopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-hydroxy-4-oxoheptanamide |
|---|---|
| PubChem CID | 158270971 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (2R,5S,6R)-2-(4-aminobutyl)-N-[(2S)-1-deuterio-1-oxopropan-2-yl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-hydroxy-4-oxoheptanamide |
| SMILES | [2H]C(=O)[C@H](C)NC(=O)[C@H](CCCCN)CC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)[C@@H](C)O |
| InChI | InChI=1S/C24H38N4O7/c1-16(15-29)26-24(35)18(8-5-6-12-25)14-19(31)23(17(2)30)27-20(32)9-4-3-7-13-28-21(33)10-11-22(28)34/h10-11,15-18,23,30H,3-9,12-14,25H2,1-2H3,(H,26,35)(H,27,32)/t16-,17+,18+,23-/m0/s1/i15D |
| InChIKey | GJAGMIUZSLMGLW-SHUSIKLYSA-N |
| XLogP | -0.25 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|