C24H39N5O6 — CID 158843747
(5S)-2-[3-(carbamoylamino)propyl]-N-(2-deuterioethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide (PubChem CID 158843747) has the molecular formula C24H39N5O6 and a molecular weight of 494.61 g/mol. Its IUPAC name is (5S)-2-[3-(carbamoylamino)propyl]-N-(2-deuterioethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide.
| Compound Name | (5S)-2-[3-(carbamoylamino)propyl]-N-(2-deuterioethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 158843747 |
| Molecular Formula | C24H39N5O6 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | (5S)-2-[3-(carbamoylamino)propyl]-N-(2-deuterioethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanamide |
| SMILES | [2H]CCNC(=O)C(CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C24H39N5O6/c1-4-26-23(34)17(9-8-13-27-24(25)35)15-18(30)22(16(2)3)28-19(31)10-6-5-7-14-29-20(32)11-12-21(29)33/h11-12,16-17,22H,4-10,13-15H2,1-3H3,(H,26,34)(H,28,31)(H3,25,27,35)/t17?,22-/m0/s1/i1D |
| InChIKey | IYOKHZYDLVPZSI-WYUYMCTQSA-N |
| XLogP | 0.77 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|