C34H49N5O8 — CID 147230576
[4-[[(5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 147230576) has the molecular formula C34H49N5O8 and a molecular weight of 655.79 g/mol. Its IUPAC name is [4-[[(5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 147230576 |
| Molecular Formula | C34H49N5O8 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | [4-[[(5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)CC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H49N5O8/c1-22(2)30(38-27(41)11-7-6-8-19-39-28(42)16-17-29(39)43)26(40)20-24(10-9-18-36-33(35)46)31(44)37-25-14-12-23(13-15-25)21-47-32(45)34(3,4)5/h12-17,22,24,30H,6-11,18-21H2,1-5H3,(H,37,44)(H,38,41)(H3,35,36,46)/t24?,30-/m0/s1 |
| InChIKey | CIVJQFSPDWEBMH-FZNWDQQTSA-N |
| XLogP | 3.36 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|