C38H54N4O9 — CID 159564876
[4-[[(2R,5S)-2-(5-amino-5-oxopentyl)-5-[[9-(2,5-dioxopyrrol-1-yl)-8-oxononanoyl]amino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 159564876) has the molecular formula C38H54N4O9 and a molecular weight of 710.87 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-(5-amino-5-oxopentyl)-5-[[9-(2,5-dioxopyrrol-1-yl)-8-oxononanoyl]amino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(2R,5S)-2-(5-amino-5-oxopentyl)-5-[[9-(2,5-dioxopyrrol-1-yl)-8-oxononanoyl]amino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159564876 |
| Molecular Formula | C38H54N4O9 |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 710.39 |
| IUPAC Name | [4-[[(2R,5S)-2-(5-amino-5-oxopentyl)-5-[[9-(2,5-dioxopyrrol-1-yl)-8-oxononanoyl]amino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCCC(=O)CN1C(=O)C=CC1=O)C(=O)C[C@@H](CCCCC(N)=O)C(=O)Nc1ccc(COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C38H54N4O9/c1-25(2)35(41-32(46)15-9-7-6-8-13-29(43)23-42-33(47)20-21-34(42)48)30(44)22-27(12-10-11-14-31(39)45)36(49)40-28-18-16-26(17-19-28)24-51-37(50)38(3,4)5/h16-21,25,27,35H,6-15,22-24H2,1-5H3,(H2,39,45)(H,40,49)(H,41,46)/t27-,35+/m1/s1 |
| InChIKey | CXGHQASNJUCFRF-URNDWHGUSA-N |
| XLogP | 4.31 |
| TPSA | 199.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|