C26H45N5O6 — CID 134443436
N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-ethyl-2,5-dioxopyrrolidin-1-yl)hexanamide (PubChem CID 134443436) has the molecular formula C26H45N5O6 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-ethyl-2,5-dioxopyrrolidin-1-yl)hexanamide.
| Compound Name | N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-ethyl-2,5-dioxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 134443436 |
| Molecular Formula | C26H45N5O6 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-ethyl-2,5-dioxopyrrolidin-1-yl)hexanamide |
| SMILES | CCC1CC(=O)N(CCCCCC(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C26H45N5O6/c1-6-18-15-21(33)31(25(18)36)14-9-7-8-12-20(32)30-22(16(2)3)24(35)29-19(23(34)17(4)5)11-10-13-28-26(27)37/h16-19,22H,6-15H2,1-5H3,(H,29,35)(H,30,32)(H3,27,28,37)/t18?,19-,22-/m0/s1 |
| InChIKey | YMARXUWYRYHZOQ-MLLWHUAMSA-N |
| XLogP | 1.63 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|