C30H48N4O5 — CID 157065285
(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-(7-methyloctanoylamino)-4-oxo-N-[4-(3-oxopropyl)phenyl]heptanamide (PubChem CID 157065285) has the molecular formula C30H48N4O5 and a molecular weight of 544.74 g/mol. Its IUPAC name is (2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-(7-methyloctanoylamino)-4-oxo-N-[4-(3-oxopropyl)phenyl]heptanamide.
| Compound Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-(7-methyloctanoylamino)-4-oxo-N-[4-(3-oxopropyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 157065285 |
| Molecular Formula | C30H48N4O5 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-(7-methyloctanoylamino)-4-oxo-N-[4-(3-oxopropyl)phenyl]heptanamide |
| SMILES | CC(C)CCCCCC(=O)N[C@H](C(=O)C[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CCC=O)cc1)C(C)C |
| InChI | InChI=1S/C30H48N4O5/c1-21(2)10-6-5-7-13-27(37)34-28(22(3)4)26(36)20-24(12-8-18-32-30(31)39)29(38)33-25-16-14-23(15-17-25)11-9-19-35/h14-17,19,21-22,24,28H,5-13,18,20H2,1-4H3,(H,33,38)(H,34,37)(H3,31,32,39)/t24-,28+/m1/s1 |
| InChIKey | ABUOFTSLXNBGFD-YWEHKCAJSA-N |
| XLogP | 4.53 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|