C25H44N4O4 — CID 178057643
[4-[[6-amino-2-[[3-methyl-2-(propan-2-ylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl acetate;ethane (PubChem CID 178057643) has the molecular formula C25H44N4O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is [4-[[6-amino-2-[[3-methyl-2-(propan-2-ylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl acetate;ethane.
| Compound Name | [4-[[6-amino-2-[[3-methyl-2-(propan-2-ylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl acetate;ethane |
|---|---|
| PubChem CID | 178057643 |
| Molecular Formula | C25H44N4O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | [4-[[6-amino-2-[[3-methyl-2-(propan-2-ylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl acetate;ethane |
| SMILES | CC.CC(=O)OCc1ccc(NC(=O)C(CCCCN)NC(=O)C(NC(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H38N4O4.C2H6/c1-15(2)21(25-16(3)4)23(30)27-20(8-6-7-13-24)22(29)26-19-11-9-18(10-12-19)14-31-17(5)28;1-2/h9-12,15-16,20-21,25H,6-8,13-14,24H2,1-5H3,(H,26,29)(H,27,30);1-2H3 |
| InChIKey | SYMQDMWJGFMBMW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|