C19H29IN3O4+ — CID 148743505
[4-[[(2S)-2-[[(2S)-3-methyl-2-(propan-2-ylamino)butanoyl]amino]propanoyl]amino]phenyl]methoxycarbonyliodanium (PubChem CID 148743505) has the molecular formula C19H29IN3O4+ and a molecular weight of 490.36 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-3-methyl-2-(propan-2-ylamino)butanoyl]amino]propanoyl]amino]phenyl]methoxycarbonyliodanium.
| Compound Name | [4-[[(2S)-2-[[(2S)-3-methyl-2-(propan-2-ylamino)butanoyl]amino]propanoyl]amino]phenyl]methoxycarbonyliodanium |
|---|---|
| PubChem CID | 148743505 |
| Molecular Formula | C19H29IN3O4+ |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-3-methyl-2-(propan-2-ylamino)butanoyl]amino]propanoyl]amino]phenyl]methoxycarbonyliodanium |
| SMILES | CC(C)N[C@H](C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)[IH+])cc1)C(C)C |
| InChI | InChI=1S/C19H28IN3O4/c1-11(2)16(21-12(3)4)18(25)22-13(5)17(24)23-15-8-6-14(7-9-15)10-27-19(20)26/h6-9,11-13,16,20-21H,10H2,1-5H3,(H-,22,23,24,25)/p+1/t13-,16-/m0/s1 |
| InChIKey | ODHQMTLIDVKEND-BBRMVZONSA-O |
| XLogP | -0.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|