C14H19N3O4 — CID 178169223
[4-[2-[(2-aminoacetyl)amino]propanoylamino]phenyl]methyl acetate (PubChem CID 178169223) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is [4-[2-[(2-aminoacetyl)amino]propanoylamino]phenyl]methyl acetate.
| Compound Name | [4-[2-[(2-aminoacetyl)amino]propanoylamino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 178169223 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [4-[2-[(2-aminoacetyl)amino]propanoylamino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)C(C)NC(=O)CN)cc1 |
| InChI | InChI=1S/C14H19N3O4/c1-9(16-13(19)7-15)14(20)17-12-5-3-11(4-6-12)8-21-10(2)18/h3-6,9H,7-8,15H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | DNRRPIMWFQECNV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |