C17H25N3O4 — CID 154959057
[4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate (PubChem CID 154959057) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 154959057 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@@H](C)NC(=O)[C@H](N)C(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-10(2)15(18)17(23)19-11(3)16(22)20-14-7-5-13(6-8-14)9-24-12(4)21/h5-8,10-11,15H,9,18H2,1-4H3,(H,19,23)(H,20,22)/t11-,15-/m1/s1 |
| InChIKey | JMUDFLBZCWGHDK-IAQYHMDHSA-N |
| XLogP | 1.18 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |