C19H30N4O5 — CID 155375955
(2S)-2-amino-N-[(2S)-1-[4-[1-(2-amino-2-oxoethoxy)ethoxymethyl]anilino]-1-oxopropan-2-yl]-3-methylbutanamide (PubChem CID 155375955) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-[4-[1-(2-amino-2-oxoethoxy)ethoxymethyl]anilino]-1-oxopropan-2-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1-[4-[1-(2-amino-2-oxoethoxy)ethoxymethyl]anilino]-1-oxopropan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 155375955 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-[4-[1-(2-amino-2-oxoethoxy)ethoxymethyl]anilino]-1-oxopropan-2-yl]-3-methylbutanamide |
| SMILES | CC(OCC(N)=O)OCc1ccc(NC(=O)[C@H](C)NC(=O)[C@@H](N)C(C)C)cc1 |
| InChI | InChI=1S/C19H30N4O5/c1-11(2)17(21)19(26)22-12(3)18(25)23-15-7-5-14(6-8-15)9-27-13(4)28-10-16(20)24/h5-8,11-13,17H,9-10,21H2,1-4H3,(H2,20,24)(H,22,26)(H,23,25)/t12-,13?,17-/m0/s1 |
| InChIKey | DHDAQAQPHNCZRN-NKGYKZILSA-N |
| XLogP | 0.48 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|