C19H28IN5O5 — CID 90070627
[4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl carboniodidate (PubChem CID 90070627) has the molecular formula C19H28IN5O5 and a molecular weight of 533.37 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl carboniodidate.
| Compound Name | [4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl carboniodidate |
|---|---|
| PubChem CID | 90070627 |
| Molecular Formula | C19H28IN5O5 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl carboniodidate |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)I)cc1 |
| InChI | InChI=1S/C19H28IN5O5/c1-11(2)15(21)17(27)25-14(4-3-9-23-19(22)29)16(26)24-13-7-5-12(6-8-13)10-30-18(20)28/h5-8,11,14-15H,3-4,9-10,21H2,1-2H3,(H,24,26)(H,25,27)(H3,22,23,29)/t14-,15-/m0/s1 |
| InChIKey | DWGLNJVBBLPVLI-GJZGRUSLSA-N |
| XLogP | 1.61 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|