C29H36N6O7 — CID 59800805
[4-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-(4-methyl-2-oxochromen-7-yl)carbamate (PubChem CID 59800805) has the molecular formula C29H36N6O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is [4-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-(4-methyl-2-oxochromen-7-yl)carbamate.
| Compound Name | [4-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-(4-methyl-2-oxochromen-7-yl)carbamate |
|---|---|
| PubChem CID | 59800805 |
| Molecular Formula | C29H36N6O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | [4-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-(4-methyl-2-oxochromen-7-yl)carbamate |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)OCc3ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(N)C(C)C)cc3)ccc12 |
| InChI | InChI=1S/C29H36N6O7/c1-16(2)25(30)27(38)35-22(5-4-12-32-28(31)39)26(37)33-19-8-6-18(7-9-19)15-41-29(40)34-20-10-11-21-17(3)13-24(36)42-23(21)14-20/h6-11,13-14,16,22,25H,4-5,12,15,30H2,1-3H3,(H,33,37)(H,34,40)(H,35,38)(H3,31,32,39) |
| InChIKey | MTFCNMWMJMCOCH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 207.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|