C19H29N5O6 — CID 143394050
[4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl hydrogen carbonate (PubChem CID 143394050) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is [4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl hydrogen carbonate.
| Compound Name | [4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 143394050 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | [4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl hydrogen carbonate |
| SMILES | CC(C)[C@H](N)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)O)cc1 |
| InChI | InChI=1S/C19H29N5O6/c1-11(2)15(20)17(26)24-14(4-3-9-22-18(21)27)16(25)23-13-7-5-12(6-8-13)10-30-19(28)29/h5-8,11,14-15H,3-4,9-10,20H2,1-2H3,(H,23,25)(H,24,26)(H,28,29)(H3,21,22,27)/t14?,15-/m0/s1 |
| InChIKey | CMPUQINFJKVRNN-LOACHALJSA-N |
| XLogP | 0.74 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|