C22H35N5O5S — CID 170203087
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl methylsulfanylformate (PubChem CID 170203087) has the molecular formula C22H35N5O5S and a molecular weight of 481.62 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl methylsulfanylformate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl methylsulfanylformate |
|---|---|
| PubChem CID | 170203087 |
| Molecular Formula | C22H35N5O5S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl methylsulfanylformate |
| SMILES | CCN[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)SC)cc1)C(C)C |
| InChI | InChI=1S/C22H35N5O5S/c1-5-24-18(14(2)3)20(29)27-17(7-6-12-25-21(23)30)19(28)26-16-10-8-15(9-11-16)13-32-22(31)33-4/h8-11,14,17-18,24H,5-7,12-13H2,1-4H3,(H,26,28)(H,27,29)(H3,23,25,30)/t17-,18-/m0/s1 |
| InChIKey | BADPOKWSFIUKBH-ROUUACIJSA-N |
| XLogP | 2.19 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|