C22H34N6O5 — CID 155453182
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl aziridine-1-carboxylate (PubChem CID 155453182) has the molecular formula C22H34N6O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl aziridine-1-carboxylate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl aziridine-1-carboxylate |
|---|---|
| PubChem CID | 155453182 |
| Molecular Formula | C22H34N6O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl aziridine-1-carboxylate |
| SMILES | CN[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)N2CC2)cc1)C(C)C |
| InChI | InChI=1S/C22H34N6O5/c1-14(2)18(24-3)20(30)27-17(5-4-10-25-21(23)31)19(29)26-16-8-6-15(7-9-16)13-33-22(32)28-11-12-28/h6-9,14,17-18,24H,4-5,10-13H2,1-3H3,(H,26,29)(H,27,30)(H3,23,25,31)/t17-,18-/m0/s1 |
| InChIKey | CRMMEPYEEUYEDR-ROUUACIJSA-N |
| XLogP | 0.75 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|