C26H34N6O7 — CID 87431525
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrosophenyl) carbonate (PubChem CID 87431525) has the molecular formula C26H34N6O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrosophenyl) carbonate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrosophenyl) carbonate |
|---|---|
| PubChem CID | 87431525 |
| Molecular Formula | C26H34N6O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrosophenyl) carbonate |
| SMILES | CN[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc(N=O)cc2)cc1)C(C)C |
| InChI | InChI=1S/C26H34N6O7/c1-16(2)22(28-3)24(34)31-21(5-4-14-29-25(27)35)23(33)30-18-8-6-17(7-9-18)15-38-26(36)39-20-12-10-19(32-37)11-13-20/h6-13,16,21-22,28H,4-5,14-15H2,1-3H3,(H,30,33)(H,31,34)(H3,27,29,35)/t21-,22-/m0/s1 |
| InChIKey | HMZQYBJCWJOHNS-VXKWHMMOSA-N |
| XLogP | 2.92 |
| TPSA | 190.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|