C21H33N5O5 — CID 130458016
[4-[[(2S)-6-(carbamoylamino)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl formate (PubChem CID 130458016) has the molecular formula C21H33N5O5 and a molecular weight of 435.53 g/mol. Its IUPAC name is [4-[[(2S)-6-(carbamoylamino)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl formate.
| Compound Name | [4-[[(2S)-6-(carbamoylamino)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl formate |
|---|---|
| PubChem CID | 130458016 |
| Molecular Formula | C21H33N5O5 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | [4-[[(2S)-6-(carbamoylamino)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hexanoyl]amino]phenyl]methyl formate |
| SMILES | CNC(C(=O)N[C@@H](CCCCNC(N)=O)C(=O)Nc1ccc(COC=O)cc1)C(C)C |
| InChI | InChI=1S/C21H33N5O5/c1-14(2)18(23-3)20(29)26-17(6-4-5-11-24-21(22)30)19(28)25-16-9-7-15(8-10-16)12-31-13-27/h7-10,13-14,17-18,23H,4-6,11-12H2,1-3H3,(H,25,28)(H,26,29)(H3,22,24,30)/t17-,18?/m0/s1 |
| InChIKey | NEYYDKUETZLYPK-ZENAZSQFSA-N |
| XLogP | 0.87 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|