C20H30BN5O5 — CID 174022503
CID 174022503 (PubChem CID 174022503) has the molecular formula C20H30BN5O5 and a molecular weight of 431.30 g/mol.
| Compound Name | CID 174022503 |
|---|---|
| PubChem CID | 174022503 |
| Molecular Formula | C20H30BN5O5 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC)C(C)C)cc1 |
| InChI | InChI=1S/C20H30BN5O5/c1-12(2)16(23-3)18(28)26-15(5-4-10-24-20(22)30)17(27)25-14-8-6-13(7-9-14)11-31-19(21)29/h6-9,12,15-16,23H,4-5,10-11H2,1-3H3,(H,25,27)(H,26,28)(H3,22,24,30)/t15-,16?/m0/s1 |
| InChIKey | DCOQMMKUMUYUQI-VYRBHSGPSA-N |
| XLogP | 0.61 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|