C20H31N5O5 — CID 118494543
[4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate (PubChem CID 118494543) has the molecular formula C20H31N5O5 and a molecular weight of 421.50 g/mol. Its IUPAC name is [4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 118494543 |
| Molecular Formula | C20H31N5O5 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | [4-[[(2R)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@@H](CCCNC(N)=O)NC(=O)[C@H](N)C(C)C)cc1 |
| InChI | InChI=1S/C20H31N5O5/c1-12(2)17(21)19(28)25-16(5-4-10-23-20(22)29)18(27)24-15-8-6-14(7-9-15)11-30-13(3)26/h6-9,12,16-17H,4-5,10-11,21H2,1-3H3,(H,24,27)(H,25,28)(H3,22,23,29)/t16-,17-/m1/s1 |
| InChIKey | FWXMSTPYYXBXBV-IAGOWNOFSA-N |
| XLogP | 0.60 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|