C22H30N4O6 — CID 161484421
[4-[[(2S)-2-[(1-acetylcyclobutanecarbonyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate (PubChem CID 161484421) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is [4-[[(2S)-2-[(1-acetylcyclobutanecarbonyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2S)-2-[(1-acetylcyclobutanecarbonyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 161484421 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [4-[[(2S)-2-[(1-acetylcyclobutanecarbonyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C2(C(C)=O)CCC2)cc1 |
| InChI | InChI=1S/C22H30N4O6/c1-14(27)22(10-4-11-22)20(30)26-18(5-3-12-24-21(23)31)19(29)25-17-8-6-16(7-9-17)13-32-15(2)28/h6-9,18H,3-5,10-13H2,1-2H3,(H,25,29)(H,26,30)(H3,23,24,31)/t18-/m0/s1 |
| InChIKey | SNVRKKVHNRKRRN-SFHVURJKSA-N |
| XLogP | 1.38 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|