C33H45BN4O8 — CID 162683185
ethyl 1-[[(2S)-5-(carbamoylamino)-1-oxo-1-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]anilino]pentan-2-yl]carbamoyl]cyclobutane-1-carboxylate (PubChem CID 162683185) has the molecular formula C33H45BN4O8 and a molecular weight of 636.56 g/mol. Its IUPAC name is ethyl 1-[[(2S)-5-(carbamoylamino)-1-oxo-1-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]anilino]pentan-2-yl]carbamoyl]cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[[(2S)-5-(carbamoylamino)-1-oxo-1-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]anilino]pentan-2-yl]carbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 162683185 |
| Molecular Formula | C33H45BN4O8 |
| Molecular Weight | 636.56 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | ethyl 1-[[(2S)-5-(carbamoylamino)-1-oxo-1-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]anilino]pentan-2-yl]carbamoyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc2ccc(COc3ccccc3B3OC(C)(C)C(C)(C)O3)cc2)CCC1 |
| InChI | InChI=1S/C33H45BN4O8/c1-6-43-29(41)33(18-10-19-33)28(40)38-25(12-9-20-36-30(35)42)27(39)37-23-16-14-22(15-17-23)21-44-26-13-8-7-11-24(26)34-45-31(2,3)32(4,5)46-34/h7-8,11,13-17,25H,6,9-10,12,18-21H2,1-5H3,(H,37,39)(H,38,40)(H3,35,36,42)/t25-/m0/s1 |
| InChIKey | VZRLDOSWBKKFNJ-VWLOTQADSA-N |
| XLogP | 3.17 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|