C22H31N3O6 — CID 123529053
ethyl 1-[[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]cyclobutane-1-carboxylate (PubChem CID 123529053) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 1-[[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 123529053 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | ethyl 1-[[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)NC(CCCNC(N)=O)C(=O)Cc2ccc(CO)cc2)CCC1 |
| InChI | InChI=1S/C22H31N3O6/c1-2-31-20(29)22(10-4-11-22)19(28)25-17(5-3-12-24-21(23)30)18(27)13-15-6-8-16(14-26)9-7-15/h6-9,17,26H,2-5,10-14H2,1H3,(H,25,28)(H3,23,24,30) |
| InChIKey | OBKDSUOSAVZXOR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|