C24H35N3O6 — CID 148717056
[4-[(3S)-6-(carbamoylamino)-2-oxo-3-[[(2S)-4-oxo-2-propan-2-ylhexanoyl]amino]hexyl]phenyl]methyl deuterioformate (PubChem CID 148717056) has the molecular formula C24H35N3O6 and a molecular weight of 462.57 g/mol. Its IUPAC name is [4-[(3S)-6-(carbamoylamino)-2-oxo-3-[[(2S)-4-oxo-2-propan-2-ylhexanoyl]amino]hexyl]phenyl]methyl deuterioformate.
| Compound Name | [4-[(3S)-6-(carbamoylamino)-2-oxo-3-[[(2S)-4-oxo-2-propan-2-ylhexanoyl]amino]hexyl]phenyl]methyl deuterioformate |
|---|---|
| PubChem CID | 148717056 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [4-[(3S)-6-(carbamoylamino)-2-oxo-3-[[(2S)-4-oxo-2-propan-2-ylhexanoyl]amino]hexyl]phenyl]methyl deuterioformate |
| SMILES | [2H]C(=O)OCc1ccc(CC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](CC(=O)CC)C(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O6/c1-4-19(29)13-20(16(2)3)23(31)27-21(6-5-11-26-24(25)32)22(30)12-17-7-9-18(10-8-17)14-33-15-28/h7-10,15-16,20-21H,4-6,11-14H2,1-3H3,(H,27,31)(H3,25,26,32)/t20-,21-/m0/s1/i15D |
| InChIKey | NYIGEJDZXPGBDX-VDUDQWPSSA-N |
| XLogP | 2.05 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|