C26H38N4O5S — CID 159513743
tert-butyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-(isothiocyanatomethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate (PubChem CID 159513743) has the molecular formula C26H38N4O5S and a molecular weight of 518.68 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-(isothiocyanatomethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate.
| Compound Name | tert-butyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-(isothiocyanatomethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 159513743 |
| Molecular Formula | C26H38N4O5S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | tert-butyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-(isothiocyanatomethyl)phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate |
| SMILES | CC(C)[C@H](CC(=O)OC(C)(C)C)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Cc1ccc(CN=C=S)cc1 |
| InChI | InChI=1S/C26H38N4O5S/c1-17(2)20(14-23(32)35-26(3,4)5)24(33)30-21(7-6-12-29-25(27)34)22(31)13-18-8-10-19(11-9-18)15-28-16-36/h8-11,17,20-21H,6-7,12-15H2,1-5H3,(H,30,33)(H3,27,29,34)/t20-,21-/m0/s1 |
| InChIKey | VGWHSBOAGZIKRF-SFTDATJTSA-N |
| XLogP | 3.34 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|