C30H43N5O6 — CID 58069441
(2S)-N-[(3S)-6-(carbamoylamino)-1-(4-methylphenyl)-2-oxohexan-3-yl]-5-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-propan-2-ylpentanamide (PubChem CID 58069441) has the molecular formula C30H43N5O6 and a molecular weight of 569.70 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(carbamoylamino)-1-(4-methylphenyl)-2-oxohexan-3-yl]-5-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-propan-2-ylpentanamide.
| Compound Name | (2S)-N-[(3S)-6-(carbamoylamino)-1-(4-methylphenyl)-2-oxohexan-3-yl]-5-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 58069441 |
| Molecular Formula | C30H43N5O6 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | (2S)-N-[(3S)-6-(carbamoylamino)-1-(4-methylphenyl)-2-oxohexan-3-yl]-5-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-propan-2-ylpentanamide |
| SMILES | Cc1ccc(CC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](CCCNC(=O)CCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C30H43N5O6/c1-20(2)23(7-4-16-32-26(37)9-6-18-35-27(38)14-15-28(35)39)29(40)34-24(8-5-17-33-30(31)41)25(36)19-22-12-10-21(3)11-13-22/h10-15,20,23-24H,4-9,16-19H2,1-3H3,(H,32,37)(H,34,40)(H3,31,33,41)/t23-,24-/m0/s1 |
| InChIKey | LKCSHBZHIZPQGV-ZEQRLZLVSA-N |
| XLogP | 1.91 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|