C24H37N3O5 — CID 161120355
[4-[(3R)-6-(carbamoylamino)-2-oxo-3-[[(2R)-2-propan-2-ylpentanoyl]amino]hexyl]phenyl]methyl acetate (PubChem CID 161120355) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is [4-[(3R)-6-(carbamoylamino)-2-oxo-3-[[(2R)-2-propan-2-ylpentanoyl]amino]hexyl]phenyl]methyl acetate.
| Compound Name | [4-[(3R)-6-(carbamoylamino)-2-oxo-3-[[(2R)-2-propan-2-ylpentanoyl]amino]hexyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 161120355 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | [4-[(3R)-6-(carbamoylamino)-2-oxo-3-[[(2R)-2-propan-2-ylpentanoyl]amino]hexyl]phenyl]methyl acetate |
| SMILES | CCC[C@@H](C(=O)N[C@H](CCCNC(N)=O)C(=O)Cc1ccc(COC(C)=O)cc1)C(C)C |
| InChI | InChI=1S/C24H37N3O5/c1-5-7-20(16(2)3)23(30)27-21(8-6-13-26-24(25)31)22(29)14-18-9-11-19(12-10-18)15-32-17(4)28/h9-12,16,20-21H,5-8,13-15H2,1-4H3,(H,27,30)(H3,25,26,31)/t20-,21-/m1/s1 |
| InChIKey | BSXYOXFHRRONIJ-NHCUHLMSSA-N |
| XLogP | 2.87 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|