C27H34N4O8 — CID 157146605
[4-[(3S)-6-(carbamoylamino)-3-[[(2S)-2,3-dimethylbutanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 157146605) has the molecular formula C27H34N4O8 and a molecular weight of 542.59 g/mol. Its IUPAC name is [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-2,3-dimethylbutanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-2,3-dimethylbutanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 157146605 |
| Molecular Formula | C27H34N4O8 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-2,3-dimethylbutanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)[C@H](C)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Cc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H34N4O8/c1-17(2)18(3)25(33)30-23(5-4-14-29-26(28)34)24(32)15-19-6-8-20(9-7-19)16-38-27(35)39-22-12-10-21(11-13-22)31(36)37/h6-13,17-18,23H,4-5,14-16H2,1-3H3,(H,30,33)(H3,28,29,34)/t18-,23-/m0/s1 |
| InChIKey | FJILWNQJYPFDBL-MBSDFSHPSA-N |
| XLogP | 3.65 |
| TPSA | 179.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|