C42H44N4O10 — CID 140783783
9H-fluoren-9-ylmethyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate (PubChem CID 140783783) has the molecular formula C42H44N4O10 and a molecular weight of 764.83 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 140783783 |
| Molecular Formula | C42H44N4O10 |
| Molecular Weight | 764.83 g/mol |
| Exact Mass | 764.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3S)-3-[[(3S)-6-(carbamoylamino)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]-2-oxohexan-3-yl]carbamoyl]-4-methylpentanoate |
| SMILES | CC(C)[C@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Cc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C42H44N4O10/c1-26(2)35(23-39(48)54-25-36-33-10-5-3-8-31(33)32-9-4-6-11-34(32)36)40(49)45-37(12-7-21-44-41(43)50)38(47)22-27-13-15-28(16-14-27)24-55-42(51)56-30-19-17-29(18-20-30)46(52)53/h3-6,8-11,13-20,26,35-37H,7,12,21-25H2,1-2H3,(H,45,49)(H3,43,44,50)/t35-,37-/m0/s1 |
| InChIKey | XWPYDJLRQXVGMJ-JSXFGMRASA-N |
| XLogP | 6.37 |
| TPSA | 206.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.83 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|