C41H43N5O10 — CID 160954158
[4-[[(2S,5S)-2-[3-(carbamoylamino)propyl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 160954158) has the molecular formula C41H43N5O10 and a molecular weight of 765.82 g/mol. Its IUPAC name is [4-[[(2S,5S)-2-[3-(carbamoylamino)propyl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[(2S,5S)-2-[3-(carbamoylamino)propyl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 160954158 |
| Molecular Formula | C41H43N5O10 |
| Molecular Weight | 765.82 g/mol |
| Exact Mass | 765.30 |
| IUPAC Name | [4-[[(2S,5S)-2-[3-(carbamoylamino)propyl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)C[C@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C41H43N5O10/c1-25(2)37(45-40(50)54-24-35-33-11-5-3-9-31(33)32-10-4-6-12-34(32)35)36(47)22-27(8-7-21-43-39(42)49)38(48)44-28-15-13-26(14-16-28)23-55-41(51)56-30-19-17-29(18-20-30)46(52)53/h3-6,9-20,25,27,35,37H,7-8,21-24H2,1-2H3,(H,44,48)(H,45,50)(H3,42,43,49)/t27-,37-/m0/s1 |
| InChIKey | WOFRXMWIQIMGQE-ZSQPVGNWSA-N |
| XLogP | 6.84 |
| TPSA | 218.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.82 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|