C44H49N5O10 — CID 159196065
[4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 159196065) has the molecular formula C44H49N5O10 and a molecular weight of 807.90 g/mol. Its IUPAC name is [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 159196065 |
| Molecular Formula | C44H49N5O10 |
| Molecular Weight | 807.90 g/mol |
| Exact Mass | 807.35 |
| IUPAC Name | [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)[C@H](CCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Cc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C44H49N5O10/c1-28(2)33(13-7-24-47-43(53)57-27-38-36-11-5-3-9-34(36)35-10-4-6-12-37(35)38)41(51)48-39(14-8-23-46-42(45)52)40(50)25-29-15-17-30(18-16-29)26-58-44(54)59-32-21-19-31(20-22-32)49(55)56/h3-6,9-12,15-22,28,33,38-39H,7-8,13-14,23-27H2,1-2H3,(H,47,53)(H,48,51)(H3,45,46,52)/t33-,39-/m0/s1 |
| InChIKey | RVAHSEHRJUAXTR-AJCPBJRWSA-N |
| XLogP | 6.95 |
| TPSA | 218.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|