C40H42N6O10 — CID 178179801
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[9H-fluoren-9-yl(methyl)carbamoyl]oxy-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 178179801) has the molecular formula C40H42N6O10 and a molecular weight of 766.81 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[9H-fluoren-9-yl(methyl)carbamoyl]oxy-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[9H-fluoren-9-yl(methyl)carbamoyl]oxy-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 178179801 |
| Molecular Formula | C40H42N6O10 |
| Molecular Weight | 766.81 g/mol |
| Exact Mass | 766.30 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[9H-fluoren-9-yl(methyl)carbamoyl]oxy-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)[C@H](OC(=O)N(C)C1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C40H42N6O10/c1-24(2)35(56-39(50)45(3)34-31-11-6-4-9-29(31)30-10-5-7-12-32(30)34)37(48)44-33(13-8-22-42-38(41)49)36(47)43-26-16-14-25(15-17-26)23-54-40(51)55-28-20-18-27(19-21-28)46(52)53/h4-7,9-12,14-21,24,33-35H,8,13,22-23H2,1-3H3,(H,43,47)(H,44,48)(H3,41,42,49)/t33-,35-/m0/s1 |
| InChIKey | VSQMBYVOIAGWQN-LRHLLKFHSA-N |
| XLogP | 6.05 |
| TPSA | 221.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.81 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|