C19H30N4O4 — CID 157276797
(2S)-2-amino-N-[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]-3-methylbutanamide (PubChem CID 157276797) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2S)-2-amino-N-[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 157276797 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2S)-2-amino-N-[6-(carbamoylamino)-1-[4-(hydroxymethyl)phenyl]-2-oxohexan-3-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NC(CCCNC(N)=O)C(=O)Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C19H30N4O4/c1-12(2)17(20)18(26)23-15(4-3-9-22-19(21)27)16(25)10-13-5-7-14(11-24)8-6-13/h5-8,12,15,17,24H,3-4,9-11,20H2,1-2H3,(H,23,26)(H3,21,22,27)/t15?,17-/m0/s1 |
| InChIKey | MBPYZDAVXITEQT-LWKPJOBUSA-N |
| XLogP | 0.21 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|