C19H31N5O4 — CID 170009615
(3S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide (PubChem CID 170009615) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide.
| Compound Name | (3S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 170009615 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (3S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)CC(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C19H31N5O4/c1-12(2)17(20)18(27)24-15(4-3-9-22-19(21)28)10-16(26)23-14-7-5-13(11-25)6-8-14/h5-8,12,15,17,25H,3-4,9-11,20H2,1-2H3,(H,23,26)(H,24,27)(H3,21,22,28)/t15-,17-/m0/s1 |
| InChIKey | UMNOSPGMCMCJBG-RDJZCZTQSA-N |
| XLogP | 0.42 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|