C19H29N5O4 — CID 139397870
2-[[(2S)-2-amino-3-methylbutanoyl]iminomethyl]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide (PubChem CID 139397870) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-3-methylbutanoyl]iminomethyl]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide.
| Compound Name | 2-[[(2S)-2-amino-3-methylbutanoyl]iminomethyl]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 139397870 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 2-[[(2S)-2-amino-3-methylbutanoyl]iminomethyl]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
| SMILES | CC(C)[C@H](N)C(=O)/N=C/C(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C19H29N5O4/c1-12(2)16(20)18(27)23-10-14(4-3-9-22-19(21)28)17(26)24-15-7-5-13(11-25)6-8-15/h5-8,10,12,14,16,25H,3-4,9,11,20H2,1-2H3,(H,24,26)(H3,21,22,28)/b23-10+/t14?,16-/m0/s1 |
| InChIKey | UEXKLVXEAPJDJG-NWIGZXPFSA-N |
| XLogP | 0.76 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|