C18H27N5O4 — CID 163393126
(2S)-2-[[(2S)-2-amino-3-methylbut-3-enoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide (PubChem CID 163393126) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-methylbut-3-enoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-methylbut-3-enoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 163393126 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbut-3-enoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
| SMILES | C=C(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C18H27N5O4/c1-11(2)15(19)17(26)23-14(4-3-9-21-18(20)27)16(25)22-13-7-5-12(10-24)6-8-13/h5-8,14-15,24H,1,3-4,9-10,19H2,2H3,(H,22,25)(H,23,26)(H3,20,21,27)/t14-,15-/m0/s1 |
| InChIKey | JQKRWJGEIKJWFP-GJZGRUSLSA-N |
| XLogP | -0.05 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|