C22H35N5O5 — CID 142463880
(2S)-2-[[2-(butanoylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide (PubChem CID 142463880) has the molecular formula C22H35N5O5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (2S)-2-[[2-(butanoylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide.
| Compound Name | (2S)-2-[[2-(butanoylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 142463880 |
| Molecular Formula | C22H35N5O5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (2S)-2-[[2-(butanoylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
| SMILES | CCCC(=O)NC(C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1)C(C)C |
| InChI | InChI=1S/C22H35N5O5/c1-4-6-18(29)27-19(14(2)3)21(31)26-17(7-5-12-24-22(23)32)20(30)25-16-10-8-15(13-28)9-11-16/h8-11,14,17,19,28H,4-7,12-13H2,1-3H3,(H,25,30)(H,26,31)(H,27,29)(H3,23,24,32)/t17-,19?/m0/s1 |
| InChIKey | PIGIMHXRGXLXCL-KKFHFHRHSA-N |
| XLogP | 0.99 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|