C27H42BrN5O6 — CID 135339909
ethyl 7-[[(2S)-1-[[(2S)-1-[4-(bromomethyl)anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate (PubChem CID 135339909) has the molecular formula C27H42BrN5O6 and a molecular weight of 612.57 g/mol. Its IUPAC name is ethyl 7-[[(2S)-1-[[(2S)-1-[4-(bromomethyl)anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate.
| Compound Name | ethyl 7-[[(2S)-1-[[(2S)-1-[4-(bromomethyl)anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate |
|---|---|
| PubChem CID | 135339909 |
| Molecular Formula | C27H42BrN5O6 |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | ethyl 7-[[(2S)-1-[[(2S)-1-[4-(bromomethyl)anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CBr)cc1)C(C)C |
| InChI | InChI=1S/C27H42BrN5O6/c1-4-39-23(35)11-7-5-6-10-22(34)33-24(18(2)3)26(37)32-21(9-8-16-30-27(29)38)25(36)31-20-14-12-19(17-28)13-15-20/h12-15,18,21,24H,4-11,16-17H2,1-3H3,(H,31,36)(H,32,37)(H,33,34)(H3,29,30,38)/t21-,24-/m0/s1 |
| InChIKey | KHBREXBINRCDMZ-URXFXBBRSA-N |
| XLogP | 3.11 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|