C31H52N6O6 — CID 163774821
[4-[[(2S)-5-(carbamoylamino)-2-[[(2R)-2-(heptanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-pentylcarbamate (PubChem CID 163774821) has the molecular formula C31H52N6O6 and a molecular weight of 604.79 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2R)-2-(heptanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-pentylcarbamate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2R)-2-(heptanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-pentylcarbamate |
|---|---|
| PubChem CID | 163774821 |
| Molecular Formula | C31H52N6O6 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.39 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2R)-2-(heptanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-pentylcarbamate |
| SMILES | CCCCCCC(=O)N[C@@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)NCCCCC)cc1)C(C)C |
| InChI | InChI=1S/C31H52N6O6/c1-5-7-9-10-14-26(38)37-27(22(3)4)29(40)36-25(13-12-20-33-30(32)41)28(39)35-24-17-15-23(16-18-24)21-43-31(42)34-19-11-8-6-2/h15-18,22,25,27H,5-14,19-21H2,1-4H3,(H,34,42)(H,35,39)(H,36,40)(H,37,38)(H3,32,33,41)/t25-,27+/m0/s1 |
| InChIKey | MJMONYUEBFQYIM-AHKZPQOWSA-N |
| XLogP | 4.09 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|