C14H20N4O5 — CID 121380327
[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamic acid (PubChem CID 121380327) has the molecular formula C14H20N4O5 and a molecular weight of 324.34 g/mol. Its IUPAC name is [5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 121380327 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamic acid |
| SMILES | NC(=O)NCCCC(NC(=O)O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C14H20N4O5/c15-13(21)16-7-1-2-11(18-14(22)23)12(20)17-10-5-3-9(8-19)4-6-10/h3-6,11,18-19H,1-2,7-8H2,(H,17,20)(H,22,23)(H3,15,16,21) |
| InChIKey | HAGMCMAJEAOSJD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|