C23H34N4O6 — CID 123967403
ethyl 1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 123967403) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is ethyl 1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123967403 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | ethyl 1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)NC(CCCNC(N)=O)C(=O)Nc2ccc(CO)cc2)CCCCC1 |
| InChI | InChI=1S/C23H34N4O6/c1-2-33-21(31)23(12-4-3-5-13-23)20(30)27-18(7-6-14-25-22(24)32)19(29)26-17-10-8-16(15-28)9-11-17/h8-11,18,28H,2-7,12-15H2,1H3,(H,26,29)(H,27,30)(H3,24,25,32) |
| InChIKey | FPERGZVLFHPFCK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|