C27H40N6O7 — CID 170292924
ethyl 1-[[(2S)-5-(carbamoylamino)-1-[4-[1-hydroxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]anilino]-1-oxopentan-2-yl]carbamoyl]cyclobutane-1-carboxylate (PubChem CID 170292924) has the molecular formula C27H40N6O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is ethyl 1-[[(2S)-5-(carbamoylamino)-1-[4-[1-hydroxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]anilino]-1-oxopentan-2-yl]carbamoyl]cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[[(2S)-5-(carbamoylamino)-1-[4-[1-hydroxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]anilino]-1-oxopentan-2-yl]carbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 170292924 |
| Molecular Formula | C27H40N6O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | ethyl 1-[[(2S)-5-(carbamoylamino)-1-[4-[1-hydroxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]anilino]-1-oxopentan-2-yl]carbamoyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc2ccc(C(O)C(=O)N3CCN(C)CC3)cc2)CCC1 |
| InChI | InChI=1S/C27H40N6O7/c1-3-40-25(38)27(11-5-12-27)24(37)31-20(6-4-13-29-26(28)39)22(35)30-19-9-7-18(8-10-19)21(34)23(36)33-16-14-32(2)15-17-33/h7-10,20-21,34H,3-6,11-17H2,1-2H3,(H,30,35)(H,31,37)(H3,28,29,39)/t20-,21?/m0/s1 |
| InChIKey | LOKWZALJSDNJNC-BGERDNNASA-N |
| XLogP | 0.10 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|