C28H38N6O8 — CID 144870773
1-N'-[(2S)-5-(carbamoylamino)-1-[4-(hydroperoxymethyl)anilino]-1-oxopentan-2-yl]-1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]cyclobutane-1,1-dicarboxamide (PubChem CID 144870773) has the molecular formula C28H38N6O8 and a molecular weight of 586.65 g/mol. Its IUPAC name is 1-N'-[(2S)-5-(carbamoylamino)-1-[4-(hydroperoxymethyl)anilino]-1-oxopentan-2-yl]-1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(2S)-5-(carbamoylamino)-1-[4-(hydroperoxymethyl)anilino]-1-oxopentan-2-yl]-1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144870773 |
| Molecular Formula | C28H38N6O8 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 1-N'-[(2S)-5-(carbamoylamino)-1-[4-(hydroperoxymethyl)anilino]-1-oxopentan-2-yl]-1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]cyclobutane-1,1-dicarboxamide |
| SMILES | NC(=O)NCCC[C@H](NC(=O)C1(C(=O)NCCCCCN2C(=O)C=CC2=O)CCC1)C(=O)Nc1ccc(COO)cc1 |
| InChI | InChI=1S/C28H38N6O8/c29-27(40)31-16-4-6-21(24(37)32-20-9-7-19(8-10-20)18-42-41)33-26(39)28(13-5-14-28)25(38)30-15-2-1-3-17-34-22(35)11-12-23(34)36/h7-12,21,41H,1-6,13-18H2,(H,30,38)(H,32,37)(H,33,39)(H3,29,31,40)/t21-/m0/s1 |
| InChIKey | OINFDOIIDZOXMO-NRFANRHFSA-N |
| XLogP | 0.93 |
| TPSA | 209.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|