C37H55IN4O7 — CID 177069162
[4-[[(2S)-2-[[1-[5-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]-6-iodohexanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 177069162) has the molecular formula C37H55IN4O7 and a molecular weight of 794.77 g/mol. Its IUPAC name is [4-[[(2S)-2-[[1-[5-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]-6-iodohexanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(2S)-2-[[1-[5-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]-6-iodohexanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177069162 |
| Molecular Formula | C37H55IN4O7 |
| Molecular Weight | 794.77 g/mol |
| Exact Mass | 794.31 |
| IUPAC Name | [4-[[(2S)-2-[[1-[5-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]-6-iodohexanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(NC(=O)[C@H](CCCCI)NC(=O)C2(C(=O)NCCCCCN3C(=O)CC(C(C)(C)C)C3=O)CCC2)cc1 |
| InChI | InChI=1S/C37H55IN4O7/c1-35(2,3)27-23-29(43)42(31(27)45)22-11-7-10-21-39-32(46)37(18-12-19-37)33(47)41-28(13-8-9-20-38)30(44)40-26-16-14-25(15-17-26)24-49-34(48)36(4,5)6/h14-17,27-28H,7-13,18-24H2,1-6H3,(H,39,46)(H,40,44)(H,41,47)/t27?,28-/m0/s1 |
| InChIKey | QMGVULOZBAORJY-CPRJBALCSA-N |
| XLogP | 5.68 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|