C29H40N4O8 — CID 166774141
[4-[[2-[[1-[5-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate (PubChem CID 166774141) has the molecular formula C29H40N4O8 and a molecular weight of 572.66 g/mol. Its IUPAC name is [4-[[2-[[1-[5-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate.
| Compound Name | [4-[[2-[[1-[5-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 166774141 |
| Molecular Formula | C29H40N4O8 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | [4-[[2-[[1-[5-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate |
| SMILES | CCC(C)C1CC(=O)N(CCCCCNC(=O)C2(C(=O)NCC(=O)Nc3ccc(COC(=O)O)cc3)CCC2)C1=O |
| InChI | InChI=1S/C29H40N4O8/c1-3-19(2)22-16-24(35)33(25(22)36)15-6-4-5-14-30-26(37)29(12-7-13-29)27(38)31-17-23(34)32-21-10-8-20(9-11-21)18-41-28(39)40/h8-11,19,22H,3-7,12-18H2,1-2H3,(H,30,37)(H,31,38)(H,32,34)(H,39,40) |
| InChIKey | XETSQQFYBNSGLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|