C24H35N5O5 — CID 144870828
[4-[[2-[[1-(ethylcarbamoyl)cyclohexanecarbonyl]amino]acetyl]amino]phenyl]methyl piperazine-1-carboxylate (PubChem CID 144870828) has the molecular formula C24H35N5O5 and a molecular weight of 473.57 g/mol. Its IUPAC name is [4-[[2-[[1-(ethylcarbamoyl)cyclohexanecarbonyl]amino]acetyl]amino]phenyl]methyl piperazine-1-carboxylate.
| Compound Name | [4-[[2-[[1-(ethylcarbamoyl)cyclohexanecarbonyl]amino]acetyl]amino]phenyl]methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144870828 |
| Molecular Formula | C24H35N5O5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [4-[[2-[[1-(ethylcarbamoyl)cyclohexanecarbonyl]amino]acetyl]amino]phenyl]methyl piperazine-1-carboxylate |
| SMILES | CCNC(=O)C1(C(=O)NCC(=O)Nc2ccc(COC(=O)N3CCNCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C24H35N5O5/c1-2-26-21(31)24(10-4-3-5-11-24)22(32)27-16-20(30)28-19-8-6-18(7-9-19)17-34-23(33)29-14-12-25-13-15-29/h6-9,25H,2-5,10-17H2,1H3,(H,26,31)(H,27,32)(H,28,30) |
| InChIKey | VRAGLHWJPISFAG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|