C31H38N4O7 — CID 145381711
[4-[[2-[[2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]acetyl]amino]phenyl]methyl acetate (PubChem CID 145381711) has the molecular formula C31H38N4O7 and a molecular weight of 578.67 g/mol. Its IUPAC name is [4-[[2-[[2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]acetyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[2-[[2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]acetyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 145381711 |
| Molecular Formula | C31H38N4O7 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [4-[[2-[[2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]acetyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)CNC(=O)C(Cc2ccccc2)NC(=O)CCCCCN2C(=O)CC(C)C2=O)cc1 |
| InChI | InChI=1S/C31H38N4O7/c1-21-17-29(39)35(31(21)41)16-8-4-7-11-27(37)34-26(18-23-9-5-3-6-10-23)30(40)32-19-28(38)33-25-14-12-24(13-15-25)20-42-22(2)36/h3,5-6,9-10,12-15,21,26H,4,7-8,11,16-20H2,1-2H3,(H,32,40)(H,33,38)(H,34,37) |
| InChIKey | DALYRGDSFGOXSA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|